C31H17F3O8 — CID 58205464
5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-1,1,1-trifluoropropan-2-yl]phenoxy]-2-benzofuran-1,3-dione (PubChem CID 58205464) has the molecular formula C31H17F3O8 and a molecular weight of 574.46 g/mol. Its IUPAC name is 5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-1,1,1-trifluoropropan-2-yl]phenoxy]-2-benzofuran-1,3-dione.
| Compound Name | 5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-1,1,1-trifluoropropan-2-yl]phenoxy]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 58205464 |
| Molecular Formula | C31H17F3O8 |
| Molecular Weight | 574.46 g/mol |
| Exact Mass | 574.09 |
| IUPAC Name | 5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-1,1,1-trifluoropropan-2-yl]phenoxy]-2-benzofuran-1,3-dione |
| SMILES | CC(c1ccc(Oc2ccc3c(c2)C(=O)OC3=O)cc1)(c1ccc(Oc2ccc3c(c2)C(=O)OC3=O)cc1)C(F)(F)F |
| InChI | InChI=1S/C31H17F3O8/c1-30(31(32,33)34,16-2-6-18(7-3-16)39-20-10-12-22-24(14-20)28(37)41-26(22)35)17-4-8-19(9-5-17)40-21-11-13-23-25(15-21)29(38)42-27(23)36/h2-15H,1H3 |
| InChIKey | QPBBEMXOPICAHL-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.46 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|