About tert-butyl 2-(3,5-diethyl-3-fluoro-1-methylcyclohexyl)oxyacetate
tert-butyl 2-(3,5-diethyl-3-fluoro-1-methylcyclohexyl)oxyacetate (PubChem CID 58205700) has the molecular formula C17H31FO3
and a molecular weight of 302.43 g/mol. Its IUPAC name is tert-butyl 2-(3,5-diethyl-3-fluoro-1-methylcyclohexyl)oxyacetate.
Molecular Properties
| Compound Name | tert-butyl 2-(3,5-diethyl-3-fluoro-1-methylcyclohexyl)oxyacetate |
| PubChem CID | 58205700 |
| Molecular Formula | C17H31FO3 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | tert-butyl 2-(3,5-diethyl-3-fluoro-1-methylcyclohexyl)oxyacetate |
| SMILES | CCC1CC(F)(CC)CC(C)(OCC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H31FO3/c1-7-13-9-16(6,12-17(18,8-2)10-13)20-11-14(19)21-15(3,4)5/h13H,7-12H2,1-6H3 |
| InChIKey | JNNSPIZUWAOHFE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 2-(3,5-diethyl-3-fluoro-1-methylcyclohexyl)oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(3,5-diethyl-3-fluoro-1-methylcyclohexyl)oxyacetate?
The IUPAC name of tert-butyl 2-(3,5-diethyl-3-fluoro-1-methylcyclohexyl)oxyacetate (CID 58205700) is tert-butyl 2-(3,5-diethyl-3-fluoro-1-methylcyclohexyl)oxyacetate.
What is the SMILES notation for tert-butyl 2-(3,5-diethyl-3-fluoro-1-methylcyclohexyl)oxyacetate?
The canonical SMILES for tert-butyl 2-(3,5-diethyl-3-fluoro-1-methylcyclohexyl)oxyacetate is CCC1CC(F)(CC)CC(C)(OCC(=O)OC(C)(C)C)C1.
What is the InChIKey of tert-butyl 2-(3,5-diethyl-3-fluoro-1-methylcyclohexyl)oxyacetate?
The InChIKey is JNNSPIZUWAOHFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31FO3/c1-7-13-9-16(6,12-17(18,8-2)10-13)20-11-14(19)21-15(3,4)5/h13H,7-12H2,1-6H3.
What are the key properties of tert-butyl 2-(3,5-diethyl-3-fluoro-1-methylcyclohexyl)oxyacetate?
tert-butyl 2-(3,5-diethyl-3-fluoro-1-methylcyclohexyl)oxyacetate has a molecular weight of 302.43 g/mol, XLogP of 4.43, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(3,5-diethyl-3-fluoro-1-methylcyclohexyl)oxyacetate is sourced from PubChem (CID 58205700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).