C20H35OS+ — CID 58205764
(5Z,7Z)-7-cyclohexyl-2-methyl-2-(thiolan-1-ium-1-yl)nona-5,7-dien-3-ol (PubChem CID 58205764) has the molecular formula C20H35OS+ and a molecular weight of 323.57 g/mol. Its IUPAC name is (5Z,7Z)-7-cyclohexyl-2-methyl-2-(thiolan-1-ium-1-yl)nona-5,7-dien-3-ol.
| Compound Name | (5Z,7Z)-7-cyclohexyl-2-methyl-2-(thiolan-1-ium-1-yl)nona-5,7-dien-3-ol |
|---|---|
| PubChem CID | 58205764 |
| Molecular Formula | C20H35OS+ |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | (5Z,7Z)-7-cyclohexyl-2-methyl-2-(thiolan-1-ium-1-yl)nona-5,7-dien-3-ol |
| SMILES | C/C=C(\C=C/CC(O)C(C)(C)[S+]1CCCC1)C1CCCCC1 |
| InChI | InChI=1S/C20H35OS/c1-4-17(18-11-6-5-7-12-18)13-10-14-19(21)20(2,3)22-15-8-9-16-22/h4,10,13,18-19,21H,5-9,11-12,14-16H2,1-3H3/q+1/b13-10-,17-4+ |
| InChIKey | RXMRSASUVWBECS-PJUYNPNVSA-N |
| XLogP | 5.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|