C19H24F12O5 — CID 58205790
[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]oxymethyl 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 58205790) has the molecular formula C19H24F12O5 and a molecular weight of 560.37 g/mol. Its IUPAC name is [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]oxymethyl 2-methyl-2-(trifluoromethyl)butanoate.
| Compound Name | [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]oxymethyl 2-methyl-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 58205790 |
| Molecular Formula | C19H24F12O5 |
| Molecular Weight | 560.37 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]oxymethyl 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OCOC1CC(C(C)(O)C(F)(F)F)CC(C(O)(C(F)(F)F)C(F)(F)F)C1)C(F)(F)F |
| InChI | InChI=1S/C19H24F12O5/c1-4-13(2,16(20,21)22)12(32)36-8-35-11-6-9(14(3,33)17(23,24)25)5-10(7-11)15(34,18(26,27)28)19(29,30)31/h9-11,33-34H,4-8H2,1-3H3 |
| InChIKey | QZDNBVODBVFBAM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.37 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|