About 4-(ethoxymethoxy)-1,2-diethyl-1-fluoro-4-methylcyclopentane
4-(ethoxymethoxy)-1,2-diethyl-1-fluoro-4-methylcyclopentane (PubChem CID 58205791) has the molecular formula C13H25FO2
and a molecular weight of 232.34 g/mol. Its IUPAC name is 4-(ethoxymethoxy)-1,2-diethyl-1-fluoro-4-methylcyclopentane.
Molecular Properties
| Compound Name | 4-(ethoxymethoxy)-1,2-diethyl-1-fluoro-4-methylcyclopentane |
| PubChem CID | 58205791 |
| Molecular Formula | C13H25FO2 |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 4-(ethoxymethoxy)-1,2-diethyl-1-fluoro-4-methylcyclopentane |
| SMILES | CCOCOC1(C)CC(CC)C(F)(CC)C1 |
| InChI | InChI=1S/C13H25FO2/c1-5-11-8-12(4,16-10-15-7-3)9-13(11,14)6-2/h11H,5-10H2,1-4H3 |
| InChIKey | VUCDKYCNPBIMED-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(ethoxymethoxy)-1,2-diethyl-1-fluoro-4-methylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethoxymethoxy)-1,2-diethyl-1-fluoro-4-methylcyclopentane?
The IUPAC name of 4-(ethoxymethoxy)-1,2-diethyl-1-fluoro-4-methylcyclopentane (CID 58205791) is 4-(ethoxymethoxy)-1,2-diethyl-1-fluoro-4-methylcyclopentane.
What is the SMILES notation for 4-(ethoxymethoxy)-1,2-diethyl-1-fluoro-4-methylcyclopentane?
The canonical SMILES for 4-(ethoxymethoxy)-1,2-diethyl-1-fluoro-4-methylcyclopentane is CCOCOC1(C)CC(CC)C(F)(CC)C1.
What is the InChIKey of 4-(ethoxymethoxy)-1,2-diethyl-1-fluoro-4-methylcyclopentane?
The InChIKey is VUCDKYCNPBIMED-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25FO2/c1-5-11-8-12(4,16-10-15-7-3)9-13(11,14)6-2/h11H,5-10H2,1-4H3.
What are the key properties of 4-(ethoxymethoxy)-1,2-diethyl-1-fluoro-4-methylcyclopentane?
4-(ethoxymethoxy)-1,2-diethyl-1-fluoro-4-methylcyclopentane has a molecular weight of 232.34 g/mol, XLogP of 3.69, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethoxymethoxy)-1,2-diethyl-1-fluoro-4-methylcyclopentane is sourced from PubChem (CID 58205791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).