About 2-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2-fluorobicyclo[2.2.1]heptane
2-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2-fluorobicyclo[2.2.1]heptane (PubChem CID 58205796) has the molecular formula C14H19F7O2
and a molecular weight of 352.29 g/mol. Its IUPAC name is 2-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2-fluorobicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 2-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2-fluorobicyclo[2.2.1]heptane |
| PubChem CID | 58205796 |
| Molecular Formula | C14H19F7O2 |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2-fluorobicyclo[2.2.1]heptane |
| SMILES | CCOCOC(CC1(F)CC2CCC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H19F7O2/c1-2-22-8-23-12(13(16,17)18,14(19,20)21)7-11(15)6-9-3-4-10(11)5-9/h9-10H,2-8H2,1H3 |
| InChIKey | LGWKYBLRXPKXLV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2-fluorobicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2-fluorobicyclo[2.2.1]heptane?
The IUPAC name of 2-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2-fluorobicyclo[2.2.1]heptane (CID 58205796) is 2-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2-fluorobicyclo[2.2.1]heptane.
What is the SMILES notation for 2-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2-fluorobicyclo[2.2.1]heptane?
The canonical SMILES for 2-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2-fluorobicyclo[2.2.1]heptane is CCOCOC(CC1(F)CC2CCC1C2)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 2-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2-fluorobicyclo[2.2.1]heptane?
The InChIKey is LGWKYBLRXPKXLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F7O2/c1-2-22-8-23-12(13(16,17)18,14(19,20)21)7-11(15)6-9-3-4-10(11)5-9/h9-10H,2-8H2,1H3.
What are the key properties of 2-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2-fluorobicyclo[2.2.1]heptane?
2-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2-fluorobicyclo[2.2.1]heptane has a molecular weight of 352.29 g/mol, XLogP of 4.78, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2-fluorobicyclo[2.2.1]heptane is sourced from PubChem (CID 58205796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).