C13H16F4O4 — CID 58205835
[7-oxo-2-(trifluoromethyl)-6-oxabicyclo[3.2.1]octan-4-yl] 2-fluoro-2-methylbutanoate (PubChem CID 58205835) has the molecular formula C13H16F4O4 and a molecular weight of 312.26 g/mol. Its IUPAC name is [7-oxo-2-(trifluoromethyl)-6-oxabicyclo[3.2.1]octan-4-yl] 2-fluoro-2-methylbutanoate.
| Compound Name | [7-oxo-2-(trifluoromethyl)-6-oxabicyclo[3.2.1]octan-4-yl] 2-fluoro-2-methylbutanoate |
|---|---|
| PubChem CID | 58205835 |
| Molecular Formula | C13H16F4O4 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | [7-oxo-2-(trifluoromethyl)-6-oxabicyclo[3.2.1]octan-4-yl] 2-fluoro-2-methylbutanoate |
| SMILES | CCC(C)(F)C(=O)OC1CC(C(F)(F)F)C2CC1OC2=O |
| InChI | InChI=1S/C13H16F4O4/c1-3-12(2,14)11(19)21-9-5-7(13(15,16)17)6-4-8(9)20-10(6)18/h6-9H,3-5H2,1-2H3 |
| InChIKey | XJBPDZQKEBKSJJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |