C18H24F12O4 — CID 58205868
1,1,1-trifluoro-2-[3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-5-[[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]oxymethoxy]cyclohexyl]propan-2-ol (PubChem CID 58205868) has the molecular formula C18H24F12O4 and a molecular weight of 532.36 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-5-[[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]oxymethoxy]cyclohexyl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-5-[[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]oxymethoxy]cyclohexyl]propan-2-ol |
|---|---|
| PubChem CID | 58205868 |
| Molecular Formula | C18H24F12O4 |
| Molecular Weight | 532.36 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | 1,1,1-trifluoro-2-[3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-5-[[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]oxymethoxy]cyclohexyl]propan-2-ol |
| SMILES | CCC(OCOC1CC(C(C)(O)C(F)(F)F)CC(C(C)(O)C(F)(F)F)C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H24F12O4/c1-4-14(17(25,26)27,18(28,29)30)34-8-33-11-6-9(12(2,31)15(19,20)21)5-10(7-11)13(3,32)16(22,23)24/h9-11,31-32H,4-8H2,1-3H3 |
| InChIKey | XYZCKOLZZKWZHH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.36 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|