About (4E)-4-ethenyl-2-methyl-2-(thiolan-1-ium-1-yl)hepta-4,6-dien-3-ol
(4E)-4-ethenyl-2-methyl-2-(thiolan-1-ium-1-yl)hepta-4,6-dien-3-ol (PubChem CID 58205897) has the molecular formula C14H23OS+
and a molecular weight of 239.40 g/mol. Its IUPAC name is (4E)-4-ethenyl-2-methyl-2-(thiolan-1-ium-1-yl)hepta-4,6-dien-3-ol.
Molecular Properties
| Compound Name | (4E)-4-ethenyl-2-methyl-2-(thiolan-1-ium-1-yl)hepta-4,6-dien-3-ol |
| PubChem CID | 58205897 |
| Molecular Formula | C14H23OS+ |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (4E)-4-ethenyl-2-methyl-2-(thiolan-1-ium-1-yl)hepta-4,6-dien-3-ol |
| SMILES | C=C/C=C(\C=C)C(O)C(C)(C)[S+]1CCCC1 |
| InChI | InChI=1S/C14H23OS/c1-5-9-12(6-2)13(15)14(3,4)16-10-7-8-11-16/h5-6,9,13,15H,1-2,7-8,10-11H2,3-4H3/q+1/b12-9+ |
| InChIKey | AQKSZWUSTSAFTO-FMIVXFBMSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-ethenyl-2-methyl-2-(thiolan-1-ium-1-yl)hepta-4,6-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-ethenyl-2-methyl-2-(thiolan-1-ium-1-yl)hepta-4,6-dien-3-ol?
The IUPAC name of (4E)-4-ethenyl-2-methyl-2-(thiolan-1-ium-1-yl)hepta-4,6-dien-3-ol (CID 58205897) is (4E)-4-ethenyl-2-methyl-2-(thiolan-1-ium-1-yl)hepta-4,6-dien-3-ol.
What is the SMILES notation for (4E)-4-ethenyl-2-methyl-2-(thiolan-1-ium-1-yl)hepta-4,6-dien-3-ol?
The canonical SMILES for (4E)-4-ethenyl-2-methyl-2-(thiolan-1-ium-1-yl)hepta-4,6-dien-3-ol is C=C/C=C(\C=C)C(O)C(C)(C)[S+]1CCCC1.
What is the InChIKey of (4E)-4-ethenyl-2-methyl-2-(thiolan-1-ium-1-yl)hepta-4,6-dien-3-ol?
The InChIKey is AQKSZWUSTSAFTO-FMIVXFBMSA-N. The full InChI is InChI=1S/C14H23OS/c1-5-9-12(6-2)13(15)14(3,4)16-10-7-8-11-16/h5-6,9,13,15H,1-2,7-8,10-11H2,3-4H3/q+1/b12-9+.
What are the key properties of (4E)-4-ethenyl-2-methyl-2-(thiolan-1-ium-1-yl)hepta-4,6-dien-3-ol?
(4E)-4-ethenyl-2-methyl-2-(thiolan-1-ium-1-yl)hepta-4,6-dien-3-ol has a molecular weight of 239.40 g/mol, XLogP of 2.84, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-ethenyl-2-methyl-2-(thiolan-1-ium-1-yl)hepta-4,6-dien-3-ol is sourced from PubChem (CID 58205897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).