About 2-propoxypyridin-3-ol
2-propoxypyridin-3-ol (PubChem CID 58205978) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 2-propoxypyridin-3-ol.
Molecular Properties
| Compound Name | 2-propoxypyridin-3-ol |
| PubChem CID | 58205978 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 2-propoxypyridin-3-ol |
| SMILES | CCCOc1ncccc1O |
| InChI | InChI=1S/C8H11NO2/c1-2-6-11-8-7(10)4-3-5-9-8/h3-5,10H,2,6H2,1H3 |
| InChIKey | QJWUAMXQJUWFBE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propoxypyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propoxypyridin-3-ol?
The IUPAC name of 2-propoxypyridin-3-ol (CID 58205978) is 2-propoxypyridin-3-ol.
What is the SMILES notation for 2-propoxypyridin-3-ol?
The canonical SMILES for 2-propoxypyridin-3-ol is CCCOc1ncccc1O.
What is the InChIKey of 2-propoxypyridin-3-ol?
The InChIKey is QJWUAMXQJUWFBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-2-6-11-8-7(10)4-3-5-9-8/h3-5,10H,2,6H2,1H3.
What are the key properties of 2-propoxypyridin-3-ol?
2-propoxypyridin-3-ol has a molecular weight of 153.18 g/mol, XLogP of 1.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxypyridin-3-ol is sourced from PubChem (CID 58205978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).