About [methyl-[1-(4-methylphenyl)ethyl]-oxo-λ6-sulfanylidene]thiourea
[methyl-[1-(4-methylphenyl)ethyl]-oxo-λ6-sulfanylidene]thiourea (PubChem CID 58206005) has the molecular formula C11H16N2OS2
and a molecular weight of 256.40 g/mol. Its IUPAC name is [methyl-[1-(4-methylphenyl)ethyl]-oxo-λ6-sulfanylidene]thiourea.
Molecular Properties
| Compound Name | [methyl-[1-(4-methylphenyl)ethyl]-oxo-λ6-sulfanylidene]thiourea |
| PubChem CID | 58206005 |
| Molecular Formula | C11H16N2OS2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | [methyl-[1-(4-methylphenyl)ethyl]-oxo-λ6-sulfanylidene]thiourea |
| SMILES | Cc1ccc(C(C)S(C)(=O)=NC(N)=S)cc1 |
| InChI | InChI=1S/C11H16N2OS2/c1-8-4-6-10(7-5-8)9(2)16(3,14)13-11(12)15/h4-7,9H,1-3H3,(H2,12,15) |
| InChIKey | ZROLDXRENZNTHS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [methyl-[1-(4-methylphenyl)ethyl]-oxo-λ6-sulfanylidene]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl-[1-(4-methylphenyl)ethyl]-oxo-λ6-sulfanylidene]thiourea?
The IUPAC name of [methyl-[1-(4-methylphenyl)ethyl]-oxo-λ6-sulfanylidene]thiourea (CID 58206005) is [methyl-[1-(4-methylphenyl)ethyl]-oxo-λ6-sulfanylidene]thiourea.
What is the SMILES notation for [methyl-[1-(4-methylphenyl)ethyl]-oxo-λ6-sulfanylidene]thiourea?
The canonical SMILES for [methyl-[1-(4-methylphenyl)ethyl]-oxo-λ6-sulfanylidene]thiourea is Cc1ccc(C(C)S(C)(=O)=NC(N)=S)cc1.
What is the InChIKey of [methyl-[1-(4-methylphenyl)ethyl]-oxo-λ6-sulfanylidene]thiourea?
The InChIKey is ZROLDXRENZNTHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2OS2/c1-8-4-6-10(7-5-8)9(2)16(3,14)13-11(12)15/h4-7,9H,1-3H3,(H2,12,15).
What are the key properties of [methyl-[1-(4-methylphenyl)ethyl]-oxo-λ6-sulfanylidene]thiourea?
[methyl-[1-(4-methylphenyl)ethyl]-oxo-λ6-sulfanylidene]thiourea has a molecular weight of 256.40 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl-[1-(4-methylphenyl)ethyl]-oxo-λ6-sulfanylidene]thiourea is sourced from PubChem (CID 58206005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).