About tert-butyl (E,3S)-5-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate
tert-butyl (E,3S)-5-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate (PubChem CID 58206079) has the molecular formula C20H29NO6S
and a molecular weight of 411.52 g/mol. Its IUPAC name is tert-butyl (E,3S)-5-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate.
Molecular Properties
| Compound Name | tert-butyl (E,3S)-5-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| PubChem CID | 58206079 |
| Molecular Formula | C20H29NO6S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | tert-butyl (E,3S)-5-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](/C=C/S(=O)(=O)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29NO6S/c1-19(2,3)26-17(22)14-15(21-18(23)27-20(4,5)6)12-13-28(24,25)16-10-8-7-9-11-16/h7-13,15H,14H2,1-6H3,(H,21,23)/b13-12+/t15-/m1/s1 |
| InChIKey | VUAFUTLGMQEWHT-RDRICISKSA-N |
| XLogP | 3.60 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl (E,3S)-5-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (E,3S)-5-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate?
The IUPAC name of tert-butyl (E,3S)-5-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate (CID 58206079) is tert-butyl (E,3S)-5-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate.
What is the SMILES notation for tert-butyl (E,3S)-5-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate?
The canonical SMILES for tert-butyl (E,3S)-5-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate is CC(C)(C)OC(=O)C[C@@H](/C=C/S(=O)(=O)c1ccccc1)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (E,3S)-5-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate?
The InChIKey is VUAFUTLGMQEWHT-RDRICISKSA-N. The full InChI is InChI=1S/C20H29NO6S/c1-19(2,3)26-17(22)14-15(21-18(23)27-20(4,5)6)12-13-28(24,25)16-10-8-7-9-11-16/h7-13,15H,14H2,1-6H3,(H,21,23)/b13-12+/t15-/m1/s1.
What are the key properties of tert-butyl (E,3S)-5-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate?
tert-butyl (E,3S)-5-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate has a molecular weight of 411.52 g/mol, XLogP of 3.60, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (E,3S)-5-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate is sourced from PubChem (CID 58206079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).