C21H26N2O3 — CID 58206147
prop-2-enyl (2S,5S)-5-amino-4-oxo-2-propan-2-yl-6-quinolin-2-ylhexanoate (PubChem CID 58206147) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is prop-2-enyl (2S,5S)-5-amino-4-oxo-2-propan-2-yl-6-quinolin-2-ylhexanoate.
| Compound Name | prop-2-enyl (2S,5S)-5-amino-4-oxo-2-propan-2-yl-6-quinolin-2-ylhexanoate |
|---|---|
| PubChem CID | 58206147 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | prop-2-enyl (2S,5S)-5-amino-4-oxo-2-propan-2-yl-6-quinolin-2-ylhexanoate |
| SMILES | C=CCOC(=O)[C@@H](CC(=O)[C@@H](N)Cc1ccc2ccccc2n1)C(C)C |
| InChI | InChI=1S/C21H26N2O3/c1-4-11-26-21(25)17(14(2)3)13-20(24)18(22)12-16-10-9-15-7-5-6-8-19(15)23-16/h4-10,14,17-18H,1,11-13,22H2,2-3H3/t17-,18-/m0/s1 |
| InChIKey | WDNDFZJYHWPPNS-ROUUACIJSA-N |
| XLogP | 3.07 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|