C26H35NO3 — CID 58206324
(2S,15S,16S)-5-(cyclopropylmethyl)-16-(2-hydroxypropan-2-yl)-15-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol (PubChem CID 58206324) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is (2S,15S,16S)-5-(cyclopropylmethyl)-16-(2-hydroxypropan-2-yl)-15-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol.
| Compound Name | (2S,15S,16S)-5-(cyclopropylmethyl)-16-(2-hydroxypropan-2-yl)-15-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol |
|---|---|
| PubChem CID | 58206324 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | (2S,15S,16S)-5-(cyclopropylmethyl)-16-(2-hydroxypropan-2-yl)-15-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol |
| SMILES | CC(C)(O)[C@H]1CC23CC[C@]1(C)C1Oc4c(O)ccc5c4[C@@]12CCN(CC1CC1)C3C5 |
| InChI | InChI=1S/C26H35NO3/c1-23(2,29)18-13-25-9-8-24(18,3)22-26(25)10-11-27(14-15-4-5-15)19(25)12-16-6-7-17(28)21(30-22)20(16)26/h6-7,15,18-19,22,28-29H,4-5,8-14H2,1-3H3/t18-,19?,22?,24+,25?,26+/m1/s1 |
| InChIKey | BMYGQSDDXZVXTA-VQZZPPNNSA-N |
| XLogP | 4.01 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |