About 7-chloro-2,6-dimethylpyrazolo[1,5-a]pyrimidin-5-amine
7-chloro-2,6-dimethylpyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 58206890) has the molecular formula C8H9ClN4
and a molecular weight of 196.64 g/mol. Its IUPAC name is 7-chloro-2,6-dimethylpyrazolo[1,5-a]pyrimidin-5-amine.
Molecular Properties
| Compound Name | 7-chloro-2,6-dimethylpyrazolo[1,5-a]pyrimidin-5-amine |
| PubChem CID | 58206890 |
| Molecular Formula | C8H9ClN4 |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 7-chloro-2,6-dimethylpyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | Cc1cc2nc(N)c(C)c(Cl)n2n1 |
| InChI | InChI=1S/C8H9ClN4/c1-4-3-6-11-8(10)5(2)7(9)13(6)12-4/h3H,1-2H3,(H2,10,11) |
| InChIKey | KYFSNAOQTSXFOY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-2,6-dimethylpyrazolo[1,5-a]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2,6-dimethylpyrazolo[1,5-a]pyrimidin-5-amine?
The IUPAC name of 7-chloro-2,6-dimethylpyrazolo[1,5-a]pyrimidin-5-amine (CID 58206890) is 7-chloro-2,6-dimethylpyrazolo[1,5-a]pyrimidin-5-amine.
What is the SMILES notation for 7-chloro-2,6-dimethylpyrazolo[1,5-a]pyrimidin-5-amine?
The canonical SMILES for 7-chloro-2,6-dimethylpyrazolo[1,5-a]pyrimidin-5-amine is Cc1cc2nc(N)c(C)c(Cl)n2n1.
What is the InChIKey of 7-chloro-2,6-dimethylpyrazolo[1,5-a]pyrimidin-5-amine?
The InChIKey is KYFSNAOQTSXFOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN4/c1-4-3-6-11-8(10)5(2)7(9)13(6)12-4/h3H,1-2H3,(H2,10,11).
What are the key properties of 7-chloro-2,6-dimethylpyrazolo[1,5-a]pyrimidin-5-amine?
7-chloro-2,6-dimethylpyrazolo[1,5-a]pyrimidin-5-amine has a molecular weight of 196.64 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2,6-dimethylpyrazolo[1,5-a]pyrimidin-5-amine is sourced from PubChem (CID 58206890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).