About CID 58207377
CID 58207377 (PubChem CID 58207377) has the molecular formula C21H21N4OS
and a molecular weight of 377.49 g/mol.
Molecular Properties
| Compound Name | CID 58207377 |
| PubChem CID | 58207377 |
| Molecular Formula | C21H21N4OS |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | — |
| SMILES | Cc1sc(N2CCCC(c3ccccc3)C2)nc1C(=O)c1cccnc1[NH] |
| InChI | InChI=1S/C21H21N4OS/c1-14-18(19(26)17-10-5-11-23-20(17)22)24-21(27-14)25-12-6-9-16(13-25)15-7-3-2-4-8-15/h2-5,7-8,10-11,16,22H,6,9,12-13H2,1H3 |
| InChIKey | KOZWGHLMOOILIN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 58207377 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58207377?
The IUPAC name of CID 58207377 (CID 58207377) is not available.
What is the SMILES notation for CID 58207377?
The canonical SMILES for CID 58207377 is Cc1sc(N2CCCC(c3ccccc3)C2)nc1C(=O)c1cccnc1[NH].
What is the InChIKey of CID 58207377?
The InChIKey is KOZWGHLMOOILIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N4OS/c1-14-18(19(26)17-10-5-11-23-20(17)22)24-21(27-14)25-12-6-9-16(13-25)15-7-3-2-4-8-15/h2-5,7-8,10-11,16,22H,6,9,12-13H2,1H3.
What are the key properties of CID 58207377?
CID 58207377 has a molecular weight of 377.49 g/mol, XLogP of 4.38, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58207377 is sourced from PubChem (CID 58207377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).