C30H30N4O — CID 58207469
[2-methyl-5-(2-phenylethyl)-3-pyridinyl]-[6-(3-phenylpiperazin-1-yl)-2-pyridinyl]methanone (PubChem CID 58207469) has the molecular formula C30H30N4O and a molecular weight of 462.60 g/mol. Its IUPAC name is [2-methyl-5-(2-phenylethyl)-3-pyridinyl]-[6-(3-phenylpiperazin-1-yl)-2-pyridinyl]methanone.
| Compound Name | [2-methyl-5-(2-phenylethyl)-3-pyridinyl]-[6-(3-phenylpiperazin-1-yl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 58207469 |
| Molecular Formula | C30H30N4O |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | [2-methyl-5-(2-phenylethyl)-3-pyridinyl]-[6-(3-phenylpiperazin-1-yl)-2-pyridinyl]methanone |
| SMILES | Cc1ncc(CCc2ccccc2)cc1C(=O)c1cccc(N2CCNC(c3ccccc3)C2)n1 |
| InChI | InChI=1S/C30H30N4O/c1-22-26(19-24(20-32-22)16-15-23-9-4-2-5-10-23)30(35)27-13-8-14-29(33-27)34-18-17-31-28(21-34)25-11-6-3-7-12-25/h2-14,19-20,28,31H,15-18,21H2,1H3 |
| InChIKey | WYOQNLQDHOSZTH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |