About [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(3-hydroxyphenyl)-2-methyl-3-pyridinyl]methanone
[6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(3-hydroxyphenyl)-2-methyl-3-pyridinyl]methanone (PubChem CID 58207495) has the molecular formula C23H24N4O2
and a molecular weight of 388.47 g/mol. Its IUPAC name is [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(3-hydroxyphenyl)-2-methyl-3-pyridinyl]methanone.
Molecular Properties
| Compound Name | [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(3-hydroxyphenyl)-2-methyl-3-pyridinyl]methanone |
| PubChem CID | 58207495 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(3-hydroxyphenyl)-2-methyl-3-pyridinyl]methanone |
| SMILES | Cc1ncc(-c2cccc(O)c2)cc1C(=O)c1cccc(N2CCCNCC2)n1 |
| InChI | InChI=1S/C23H24N4O2/c1-16-20(14-18(15-25-16)17-5-2-6-19(28)13-17)23(29)21-7-3-8-22(26-21)27-11-4-9-24-10-12-27/h2-3,5-8,13-15,24,28H,4,9-12H2,1H3 |
| InChIKey | MCDZYTBGYHYQPG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(3-hydroxyphenyl)-2-methyl-3-pyridinyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(3-hydroxyphenyl)-2-methyl-3-pyridinyl]methanone?
The IUPAC name of [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(3-hydroxyphenyl)-2-methyl-3-pyridinyl]methanone (CID 58207495) is [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(3-hydroxyphenyl)-2-methyl-3-pyridinyl]methanone.
What is the SMILES notation for [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(3-hydroxyphenyl)-2-methyl-3-pyridinyl]methanone?
The canonical SMILES for [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(3-hydroxyphenyl)-2-methyl-3-pyridinyl]methanone is Cc1ncc(-c2cccc(O)c2)cc1C(=O)c1cccc(N2CCCNCC2)n1.
What is the InChIKey of [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(3-hydroxyphenyl)-2-methyl-3-pyridinyl]methanone?
The InChIKey is MCDZYTBGYHYQPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O2/c1-16-20(14-18(15-25-16)17-5-2-6-19(28)13-17)23(29)21-7-3-8-22(26-21)27-11-4-9-24-10-12-27/h2-3,5-8,13-15,24,28H,4,9-12H2,1H3.
What are the key properties of [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(3-hydroxyphenyl)-2-methyl-3-pyridinyl]methanone?
[6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(3-hydroxyphenyl)-2-methyl-3-pyridinyl]methanone has a molecular weight of 388.47 g/mol, XLogP of 3.19, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(3-hydroxyphenyl)-2-methyl-3-pyridinyl]methanone is sourced from PubChem (CID 58207495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).