C34H32FN3O6S2 — CID 58207629
1-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(3-methylsulfonylphenyl)pentane-2,4-dione (PubChem CID 58207629) has the molecular formula C34H32FN3O6S2 and a molecular weight of 661.78 g/mol. Its IUPAC name is 1-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(3-methylsulfonylphenyl)pentane-2,4-dione.
| Compound Name | 1-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(3-methylsulfonylphenyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 58207629 |
| Molecular Formula | C34H32FN3O6S2 |
| Molecular Weight | 661.78 g/mol |
| Exact Mass | 661.17 |
| IUPAC Name | 1-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(3-methylsulfonylphenyl)pentane-2,4-dione |
| SMILES | COCCNCc1ccc(-c2cc3nccc(Oc4ccc(CC(=O)CC(=O)Cc5cccc(S(C)(=O)=O)c5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C34H32FN3O6S2/c1-43-13-12-36-20-24-6-8-29(38-21-24)33-19-30-34(45-33)32(10-11-37-30)44-31-9-7-23(17-28(31)35)15-26(40)18-25(39)14-22-4-3-5-27(16-22)46(2,41)42/h3-11,16-17,19,21,36H,12-15,18,20H2,1-2H3 |
| InChIKey | YTSCDWIPGYSJAE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.78 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|