C34H32FN3O5S2 — CID 58207630
1-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(3-methylsulfonylphenyl)pentane-2,4-dione (PubChem CID 58207630) has the molecular formula C34H32FN3O5S2 and a molecular weight of 645.78 g/mol. Its IUPAC name is 1-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(3-methylsulfonylphenyl)pentane-2,4-dione.
| Compound Name | 1-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(3-methylsulfonylphenyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 58207630 |
| Molecular Formula | C34H32FN3O5S2 |
| Molecular Weight | 645.78 g/mol |
| Exact Mass | 645.18 |
| IUPAC Name | 1-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(3-methylsulfonylphenyl)pentane-2,4-dione |
| SMILES | CCCNCc1ccc(-c2cc3nccc(Oc4ccc(CC(=O)CC(=O)Cc5cccc(S(C)(=O)=O)c5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C34H32FN3O5S2/c1-3-12-36-20-24-7-9-29(38-21-24)33-19-30-34(44-33)32(11-13-37-30)43-31-10-8-23(17-28(31)35)15-26(40)18-25(39)14-22-5-4-6-27(16-22)45(2,41)42/h4-11,13,16-17,19,21,36H,3,12,14-15,18,20H2,1-2H3 |
| InChIKey | QZGYOEAKPDOJOY-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.78 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|