C33H32F2N3O3PS — CID 58207643
1-(5-dimethylphosphoryl-2-fluorophenyl)-3-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]propan-2-one (PubChem CID 58207643) has the molecular formula C33H32F2N3O3PS and a molecular weight of 619.67 g/mol. Its IUPAC name is 1-(5-dimethylphosphoryl-2-fluorophenyl)-3-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]propan-2-one.
| Compound Name | 1-(5-dimethylphosphoryl-2-fluorophenyl)-3-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]propan-2-one |
|---|---|
| PubChem CID | 58207643 |
| Molecular Formula | C33H32F2N3O3PS |
| Molecular Weight | 619.67 g/mol |
| Exact Mass | 619.19 |
| IUPAC Name | 1-(5-dimethylphosphoryl-2-fluorophenyl)-3-[3-fluoro-4-[2-[5-(propylaminomethyl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]propan-2-one |
| SMILES | CCCNCc1ccc(-c2cc3nccc(Oc4ccc(CC(=O)Cc5cc(P(C)(C)=O)ccc5F)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C33H32F2N3O3PS/c1-4-12-36-19-22-5-9-28(38-20-22)32-18-29-33(43-32)31(11-13-37-29)41-30-10-6-21(15-27(30)35)14-24(39)16-23-17-25(42(2,3)40)7-8-26(23)34/h5-11,13,15,17-18,20,36H,4,12,14,16,19H2,1-3H3 |
| InChIKey | FTHLEEYTBGXHNP-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.67 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|