C35H37FN3O4PS — CID 58207646
1-(3-dimethylphosphorylphenyl)-3-[3-fluoro-4-[2-[5-[(2-propoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]propan-2-one (PubChem CID 58207646) has the molecular formula C35H37FN3O4PS and a molecular weight of 645.74 g/mol. Its IUPAC name is 1-(3-dimethylphosphorylphenyl)-3-[3-fluoro-4-[2-[5-[(2-propoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]propan-2-one.
| Compound Name | 1-(3-dimethylphosphorylphenyl)-3-[3-fluoro-4-[2-[5-[(2-propoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]propan-2-one |
|---|---|
| PubChem CID | 58207646 |
| Molecular Formula | C35H37FN3O4PS |
| Molecular Weight | 645.74 g/mol |
| Exact Mass | 645.22 |
| IUPAC Name | 1-(3-dimethylphosphorylphenyl)-3-[3-fluoro-4-[2-[5-[(2-propoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]propan-2-one |
| SMILES | CCCOCCNCc1ccc(-c2cc3nccc(Oc4ccc(CC(=O)Cc5cccc(P(C)(C)=O)c5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C35H37FN3O4PS/c1-4-15-42-16-14-37-22-26-8-10-30(39-23-26)34-21-31-35(45-34)33(12-13-38-31)43-32-11-9-25(20-29(32)36)18-27(40)17-24-6-5-7-28(19-24)44(2,3)41/h5-13,19-21,23,37H,4,14-18,22H2,1-3H3 |
| InChIKey | WNFQHDLTKAXTCV-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.74 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|