C32H34FN4O3PS — CID 58207704
1-(3-dimethylphosphorylphenyl)-3-[3-fluoro-4-[2-[1-methyl-5-(propylaminomethyl)imidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]propan-2-one (PubChem CID 58207704) has the molecular formula C32H34FN4O3PS and a molecular weight of 604.69 g/mol. Its IUPAC name is 1-(3-dimethylphosphorylphenyl)-3-[3-fluoro-4-[2-[1-methyl-5-(propylaminomethyl)imidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]propan-2-one.
| Compound Name | 1-(3-dimethylphosphorylphenyl)-3-[3-fluoro-4-[2-[1-methyl-5-(propylaminomethyl)imidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]propan-2-one |
|---|---|
| PubChem CID | 58207704 |
| Molecular Formula | C32H34FN4O3PS |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | 1-(3-dimethylphosphorylphenyl)-3-[3-fluoro-4-[2-[1-methyl-5-(propylaminomethyl)imidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]propan-2-one |
| SMILES | CCCNCc1cnc(-c2cc3nccc(Oc4ccc(CC(=O)Cc5cccc(P(C)(C)=O)c5)cc4F)c3s2)n1C |
| InChI | InChI=1S/C32H34FN4O3PS/c1-5-12-34-19-23-20-36-32(37(23)2)30-18-27-31(42-30)29(11-13-35-27)40-28-10-9-22(17-26(28)33)15-24(38)14-21-7-6-8-25(16-21)41(3,4)39/h6-11,13,16-18,20,34H,5,12,14-15,19H2,1-4H3 |
| InChIKey | VVVOWQIJCMSBBT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|