C28H32FN3O2S — CID 58207712
1-[3-fluoro-4-[2-(1-methyl-5-pentylimidazol-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-4-methylpentan-2-one (PubChem CID 58207712) has the molecular formula C28H32FN3O2S and a molecular weight of 493.65 g/mol. Its IUPAC name is 1-[3-fluoro-4-[2-(1-methyl-5-pentylimidazol-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-4-methylpentan-2-one.
| Compound Name | 1-[3-fluoro-4-[2-(1-methyl-5-pentylimidazol-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-4-methylpentan-2-one |
|---|---|
| PubChem CID | 58207712 |
| Molecular Formula | C28H32FN3O2S |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 1-[3-fluoro-4-[2-(1-methyl-5-pentylimidazol-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-4-methylpentan-2-one |
| SMILES | CCCCCc1cnc(-c2cc3nccc(Oc4ccc(CC(=O)CC(C)C)cc4F)c3s2)n1C |
| InChI | InChI=1S/C28H32FN3O2S/c1-5-6-7-8-20-17-31-28(32(20)4)26-16-23-27(35-26)25(11-12-30-23)34-24-10-9-19(15-22(24)29)14-21(33)13-18(2)3/h9-12,15-18H,5-8,13-14H2,1-4H3 |
| InChIKey | HYONTLCFYZUDLE-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|