C37H39FN4O5S — CID 58207736
4-[3-fluoro-4-[2-[5-[[2-(2-propoxyethoxy)ethylamino]methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N-methyl-3-oxo-N-phenylbutanamide (PubChem CID 58207736) has the molecular formula C37H39FN4O5S and a molecular weight of 670.81 g/mol. Its IUPAC name is 4-[3-fluoro-4-[2-[5-[[2-(2-propoxyethoxy)ethylamino]methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N-methyl-3-oxo-N-phenylbutanamide.
| Compound Name | 4-[3-fluoro-4-[2-[5-[[2-(2-propoxyethoxy)ethylamino]methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N-methyl-3-oxo-N-phenylbutanamide |
|---|---|
| PubChem CID | 58207736 |
| Molecular Formula | C37H39FN4O5S |
| Molecular Weight | 670.81 g/mol |
| Exact Mass | 670.26 |
| IUPAC Name | 4-[3-fluoro-4-[2-[5-[[2-(2-propoxyethoxy)ethylamino]methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N-methyl-3-oxo-N-phenylbutanamide |
| SMILES | CCCOCCOCCNCc1ccc(-c2cc3nccc(Oc4ccc(CC(=O)CC(=O)N(C)c5ccccc5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C37H39FN4O5S/c1-3-16-45-18-19-46-17-15-39-24-27-9-11-31(41-25-27)35-23-32-37(48-35)34(13-14-40-32)47-33-12-10-26(21-30(33)38)20-29(43)22-36(44)42(2)28-7-5-4-6-8-28/h4-14,21,23,25,39H,3,15-20,22,24H2,1-2H3 |
| InChIKey | WVDHHTMRNATMQV-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.81 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|