C33H31F2N3O4S — CID 58207799
1-[3-fluoro-4-[2-[5-(4-methoxybutyl)-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-fluorophenyl)pentane-2,4-dione (PubChem CID 58207799) has the molecular formula C33H31F2N3O4S and a molecular weight of 603.69 g/mol. Its IUPAC name is 1-[3-fluoro-4-[2-[5-(4-methoxybutyl)-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-fluorophenyl)pentane-2,4-dione.
| Compound Name | 1-[3-fluoro-4-[2-[5-(4-methoxybutyl)-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-fluorophenyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 58207799 |
| Molecular Formula | C33H31F2N3O4S |
| Molecular Weight | 603.69 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | 1-[3-fluoro-4-[2-[5-(4-methoxybutyl)-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-fluorophenyl)pentane-2,4-dione |
| SMILES | COCCCCc1cnc(-c2cc3nccc(Oc4ccc(CC(=O)CC(=O)Cc5ccccc5F)cc4F)c3s2)n1C |
| InChI | InChI=1S/C33H31F2N3O4S/c1-38-23(8-5-6-14-41-2)20-37-33(38)31-19-28-32(43-31)30(12-13-36-28)42-29-11-10-21(16-27(29)35)15-24(39)18-25(40)17-22-7-3-4-9-26(22)34/h3-4,7,9-13,16,19-20H,5-6,8,14-15,17-18H2,1-2H3 |
| InChIKey | HHMDTNVYWBPVHP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.69 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|