About ethyl 8-phenyl-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]imidazo[1,2-a]pyridine-2-carboxylate
ethyl 8-phenyl-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]imidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 58207876) has the molecular formula C22H22N4O2S
and a molecular weight of 406.51 g/mol. Its IUPAC name is ethyl 8-phenyl-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]imidazo[1,2-a]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 8-phenyl-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]imidazo[1,2-a]pyridine-2-carboxylate |
| PubChem CID | 58207876 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | ethyl 8-phenyl-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]imidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cn2cc(-c3cnc(NC(C)C)s3)cc(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C22H22N4O2S/c1-4-28-21(27)18-13-26-12-16(19-11-23-22(29-19)24-14(2)3)10-17(20(26)25-18)15-8-6-5-7-9-15/h5-14H,4H2,1-3H3,(H,23,24) |
| InChIKey | ZJITZBRAFLDCAG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 8-phenyl-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]imidazo[1,2-a]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 8-phenyl-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]imidazo[1,2-a]pyridine-2-carboxylate?
The IUPAC name of ethyl 8-phenyl-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]imidazo[1,2-a]pyridine-2-carboxylate (CID 58207876) is ethyl 8-phenyl-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]imidazo[1,2-a]pyridine-2-carboxylate.
What is the SMILES notation for ethyl 8-phenyl-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]imidazo[1,2-a]pyridine-2-carboxylate?
The canonical SMILES for ethyl 8-phenyl-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]imidazo[1,2-a]pyridine-2-carboxylate is CCOC(=O)c1cn2cc(-c3cnc(NC(C)C)s3)cc(-c3ccccc3)c2n1.
What is the InChIKey of ethyl 8-phenyl-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]imidazo[1,2-a]pyridine-2-carboxylate?
The InChIKey is ZJITZBRAFLDCAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O2S/c1-4-28-21(27)18-13-26-12-16(19-11-23-22(29-19)24-14(2)3)10-17(20(26)25-18)15-8-6-5-7-9-15/h5-14H,4H2,1-3H3,(H,23,24).
What are the key properties of ethyl 8-phenyl-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]imidazo[1,2-a]pyridine-2-carboxylate?
ethyl 8-phenyl-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]imidazo[1,2-a]pyridine-2-carboxylate has a molecular weight of 406.51 g/mol, XLogP of 5.12, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 8-phenyl-6-[2-(propan-2-ylamino)-1,3-thiazol-5-yl]imidazo[1,2-a]pyridine-2-carboxylate is sourced from PubChem (CID 58207876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).