About methyl 2-[8-phenyl-6-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-2-yl]acetate
methyl 2-[8-phenyl-6-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-2-yl]acetate (PubChem CID 58207890) has the molecular formula C19H16N4O2
and a molecular weight of 332.36 g/mol. Its IUPAC name is methyl 2-[8-phenyl-6-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[8-phenyl-6-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-2-yl]acetate |
| PubChem CID | 58207890 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | methyl 2-[8-phenyl-6-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-2-yl]acetate |
| SMILES | COC(=O)Cc1cn2cc(-c3cn[nH]c3)cc(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C19H16N4O2/c1-25-18(24)8-16-12-23-11-14(15-9-20-21-10-15)7-17(19(23)22-16)13-5-3-2-4-6-13/h2-7,9-12H,8H2,1H3,(H,20,21) |
| InChIKey | COANLLCESWIWMG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[8-phenyl-6-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[8-phenyl-6-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-2-yl]acetate?
The IUPAC name of methyl 2-[8-phenyl-6-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-2-yl]acetate (CID 58207890) is methyl 2-[8-phenyl-6-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-2-yl]acetate.
What is the SMILES notation for methyl 2-[8-phenyl-6-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-2-yl]acetate?
The canonical SMILES for methyl 2-[8-phenyl-6-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-2-yl]acetate is COC(=O)Cc1cn2cc(-c3cn[nH]c3)cc(-c3ccccc3)c2n1.
What is the InChIKey of methyl 2-[8-phenyl-6-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-2-yl]acetate?
The InChIKey is COANLLCESWIWMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O2/c1-25-18(24)8-16-12-23-11-14(15-9-20-21-10-15)7-17(19(23)22-16)13-5-3-2-4-6-13/h2-7,9-12H,8H2,1H3,(H,20,21).
What are the key properties of methyl 2-[8-phenyl-6-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-2-yl]acetate?
methyl 2-[8-phenyl-6-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-2-yl]acetate has a molecular weight of 332.36 g/mol, XLogP of 3.11, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[8-phenyl-6-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-2-yl]acetate is sourced from PubChem (CID 58207890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).