C23H24N4O2S — CID 58207910
ethyl 6-[2-(butylamino)-1,3-thiazol-5-yl]-8-phenylimidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 58207910) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is ethyl 6-[2-(butylamino)-1,3-thiazol-5-yl]-8-phenylimidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | ethyl 6-[2-(butylamino)-1,3-thiazol-5-yl]-8-phenylimidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 58207910 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | ethyl 6-[2-(butylamino)-1,3-thiazol-5-yl]-8-phenylimidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | CCCCNc1ncc(-c2cc(-c3ccccc3)c3nc(C(=O)OCC)cn3c2)s1 |
| InChI | InChI=1S/C23H24N4O2S/c1-3-5-11-24-23-25-13-20(30-23)17-12-18(16-9-7-6-8-10-16)21-26-19(15-27(21)14-17)22(28)29-4-2/h6-10,12-15H,3-5,11H2,1-2H3,(H,24,25) |
| InChIKey | VGXFGUZVYYCMPX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|