About tert-butyl N-propan-2-yl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate
tert-butyl N-propan-2-yl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate (PubChem CID 58207969) has the molecular formula C23H44N2O2SSn
and a molecular weight of 531.40 g/mol. Its IUPAC name is tert-butyl N-propan-2-yl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-propan-2-yl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate |
| PubChem CID | 58207969 |
| Molecular Formula | C23H44N2O2SSn |
| Molecular Weight | 531.40 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | tert-butyl N-propan-2-yl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cnc(N(C(=O)OC(C)(C)C)C(C)C)s1 |
| InChI | InChI=1S/C11H17N2O2S.3C4H9.Sn/c1-8(2)13(9-12-6-7-16-9)10(14)15-11(3,4)5;3*1-3-4-2;/h6,8H,1-5H3;3*1,3-4H2,2H3; |
| InChIKey | BFPCWSIKYQGONT-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.40 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-propan-2-yl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-propan-2-yl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate?
The IUPAC name of tert-butyl N-propan-2-yl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate (CID 58207969) is tert-butyl N-propan-2-yl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate.
What is the SMILES notation for tert-butyl N-propan-2-yl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate?
The canonical SMILES for tert-butyl N-propan-2-yl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate is CCCC[Sn](CCCC)(CCCC)c1cnc(N(C(=O)OC(C)(C)C)C(C)C)s1.
What is the InChIKey of tert-butyl N-propan-2-yl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate?
The InChIKey is BFPCWSIKYQGONT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N2O2S.3C4H9.Sn/c1-8(2)13(9-12-6-7-16-9)10(14)15-11(3,4)5;3*1-3-4-2;/h6,8H,1-5H3;3*1,3-4H2,2H3;.
What are the key properties of tert-butyl N-propan-2-yl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate?
tert-butyl N-propan-2-yl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate has a molecular weight of 531.40 g/mol, XLogP of 7.35, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-propan-2-yl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate is sourced from PubChem (CID 58207969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).