About 2-[6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]imidazo[1,2-a]pyridin-8-yl]phenol
2-[6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]imidazo[1,2-a]pyridin-8-yl]phenol (PubChem CID 58207991) has the molecular formula C20H20N4OS
and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-[6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]imidazo[1,2-a]pyridin-8-yl]phenol.
Molecular Properties
| Compound Name | 2-[6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]imidazo[1,2-a]pyridin-8-yl]phenol |
| PubChem CID | 58207991 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-[6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]imidazo[1,2-a]pyridin-8-yl]phenol |
| SMILES | CC[C@@H](C)Nc1ncc(-c2cc(-c3ccccc3O)c3nccn3c2)s1 |
| InChI | InChI=1S/C20H20N4OS/c1-3-13(2)23-20-22-11-18(26-20)14-10-16(15-6-4-5-7-17(15)25)19-21-8-9-24(19)12-14/h4-13,25H,3H2,1-2H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | UTBPBFTVTXULRB-CYBMUJFWSA-N |
| XLogP | 5.04 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]imidazo[1,2-a]pyridin-8-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]imidazo[1,2-a]pyridin-8-yl]phenol?
The IUPAC name of 2-[6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]imidazo[1,2-a]pyridin-8-yl]phenol (CID 58207991) is 2-[6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]imidazo[1,2-a]pyridin-8-yl]phenol.
What is the SMILES notation for 2-[6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]imidazo[1,2-a]pyridin-8-yl]phenol?
The canonical SMILES for 2-[6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]imidazo[1,2-a]pyridin-8-yl]phenol is CC[C@@H](C)Nc1ncc(-c2cc(-c3ccccc3O)c3nccn3c2)s1.
What is the InChIKey of 2-[6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]imidazo[1,2-a]pyridin-8-yl]phenol?
The InChIKey is UTBPBFTVTXULRB-CYBMUJFWSA-N. The full InChI is InChI=1S/C20H20N4OS/c1-3-13(2)23-20-22-11-18(26-20)14-10-16(15-6-4-5-7-17(15)25)19-21-8-9-24(19)12-14/h4-13,25H,3H2,1-2H3,(H,22,23)/t13-/m1/s1.
What are the key properties of 2-[6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]imidazo[1,2-a]pyridin-8-yl]phenol?
2-[6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]imidazo[1,2-a]pyridin-8-yl]phenol has a molecular weight of 364.47 g/mol, XLogP of 5.04, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]imidazo[1,2-a]pyridin-8-yl]phenol is sourced from PubChem (CID 58207991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).