About 2-[4-(difluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridine-8-carboxamide
2-[4-(difluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridine-8-carboxamide (PubChem CID 58208487) has the molecular formula C18H12F2N4OS
and a molecular weight of 370.38 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridine-8-carboxamide.
Molecular Properties
| Compound Name | 2-[4-(difluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridine-8-carboxamide |
| PubChem CID | 58208487 |
| Molecular Formula | C18H12F2N4OS |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 2-[4-(difluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridine-8-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cccn2cc(-c3ccc(C(F)F)cc3)nc12 |
| InChI | InChI=1S/C18H12F2N4OS/c19-15(20)12-5-3-11(4-6-12)14-10-24-8-1-2-13(16(24)22-14)17(25)23-18-21-7-9-26-18/h1-10,15H,(H,21,23,25) |
| InChIKey | ZFKUMSMOCCAVDC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(difluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridine-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(difluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridine-8-carboxamide?
The IUPAC name of 2-[4-(difluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridine-8-carboxamide (CID 58208487) is 2-[4-(difluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridine-8-carboxamide.
What is the SMILES notation for 2-[4-(difluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridine-8-carboxamide?
The canonical SMILES for 2-[4-(difluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridine-8-carboxamide is O=C(Nc1nccs1)c1cccn2cc(-c3ccc(C(F)F)cc3)nc12.
What is the InChIKey of 2-[4-(difluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridine-8-carboxamide?
The InChIKey is ZFKUMSMOCCAVDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F2N4OS/c19-15(20)12-5-3-11(4-6-12)14-10-24-8-1-2-13(16(24)22-14)17(25)23-18-21-7-9-26-18/h1-10,15H,(H,21,23,25).
What are the key properties of 2-[4-(difluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridine-8-carboxamide?
2-[4-(difluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridine-8-carboxamide has a molecular weight of 370.38 g/mol, XLogP of 4.65, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(difluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridine-8-carboxamide is sourced from PubChem (CID 58208487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).