C13H24N2O3 — CID 58208526
3-(4-methylpiperazin-1-yl)propanoyl 2,2-dimethylpropanoate (PubChem CID 58208526) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)propanoyl 2,2-dimethylpropanoate.
| Compound Name | 3-(4-methylpiperazin-1-yl)propanoyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58208526 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)propanoyl 2,2-dimethylpropanoate |
| SMILES | CN1CCN(CCC(=O)OC(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H24N2O3/c1-13(2,3)12(17)18-11(16)5-6-15-9-7-14(4)8-10-15/h5-10H2,1-4H3 |
| InChIKey | HPFFHDXODOYCCJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|