C12H21NO4 — CID 58208599
tert-butyl (3R,3aR,6R,6aR)-3-hydroxy-6-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate (PubChem CID 58208599) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is tert-butyl (3R,3aR,6R,6aR)-3-hydroxy-6-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl (3R,3aR,6R,6aR)-3-hydroxy-6-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 58208599 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | tert-butyl (3R,3aR,6R,6aR)-3-hydroxy-6-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)[C@H]2[C@@H]1OC[C@@H]2O |
| InChI | InChI=1S/C12H21NO4/c1-7-5-13(11(15)17-12(2,3)4)9-8(14)6-16-10(7)9/h7-10,14H,5-6H2,1-4H3/t7-,8+,9-,10-/m1/s1 |
| InChIKey | HEWPXHLUCVNFMT-UTINFBMNSA-N |
| XLogP | 1.00 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |