C15H17F2NO4 — CID 58208609
benzyl (3R,3aR,6R,6aR)-6-(difluoromethyl)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate (PubChem CID 58208609) has the molecular formula C15H17F2NO4 and a molecular weight of 313.30 g/mol. Its IUPAC name is benzyl (3R,3aR,6R,6aR)-6-(difluoromethyl)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate.
| Compound Name | benzyl (3R,3aR,6R,6aR)-6-(difluoromethyl)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 58208609 |
| Molecular Formula | C15H17F2NO4 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | benzyl (3R,3aR,6R,6aR)-6-(difluoromethyl)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C[C@@H](C(F)F)[C@H]2OC[C@H](O)[C@H]21 |
| InChI | InChI=1S/C15H17F2NO4/c16-14(17)10-6-18(12-11(19)8-21-13(10)12)15(20)22-7-9-4-2-1-3-5-9/h1-5,10-14,19H,6-8H2/t10-,11+,12-,13-/m1/s1 |
| InChIKey | MEGHBXXHSYOCGX-YVECIDJPSA-N |
| XLogP | 1.65 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |