tert-butyl 2,4-dichloropyridine-3-carboxylate

C10H11Cl2NO2 — CID 58208973

IUPACtert-butyl 2,4-dichloropyridine-3-carboxylate
SMILESCC(C)(C)OC(=O)c1c(Cl)ccnc1Cl
InChIInChI=1S/C10H11Cl2NO2/c1-10(2,3)15-9(14)7-6(11)4-5-13-8(7)12/h4-5H,1-3H3
InChIKeyDFYHULXZXQOJEP-UHFFFAOYSA-N
MW248.11 g/mol
LogP3.34
Rot. Bonds1

About tert-butyl 2,4-dichloropyridine-3-carboxylate

tert-butyl 2,4-dichloropyridine-3-carboxylate (PubChem CID 58208973) has the molecular formula C10H11Cl2NO2 and a molecular weight of 248.11 g/mol. Its IUPAC name is tert-butyl 2,4-dichloropyridine-3-carboxylate.

Molecular Properties

Compound Nametert-butyl 2,4-dichloropyridine-3-carboxylate
PubChem CID58208973
Molecular FormulaC10H11Cl2NO2
Molecular Weight248.11 g/mol
Exact Mass247.02
IUPAC Nametert-butyl 2,4-dichloropyridine-3-carboxylate
SMILESCC(C)(C)OC(=O)c1c(Cl)ccnc1Cl
InChIInChI=1S/C10H11Cl2NO2/c1-10(2,3)15-9(14)7-6(11)4-5-13-8(7)12/h4-5H,1-3H3
InChIKeyDFYHULXZXQOJEP-UHFFFAOYSA-N
XLogP3.34
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.11
LogP ≤ 53.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze tert-butyl 2,4-dichloropyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2,4-dichloropyridine-3-carboxylate?
The IUPAC name of tert-butyl 2,4-dichloropyridine-3-carboxylate (CID 58208973) is tert-butyl 2,4-dichloropyridine-3-carboxylate.
What is the SMILES notation for tert-butyl 2,4-dichloropyridine-3-carboxylate?
The canonical SMILES for tert-butyl 2,4-dichloropyridine-3-carboxylate is CC(C)(C)OC(=O)c1c(Cl)ccnc1Cl.
What is the InChIKey of tert-butyl 2,4-dichloropyridine-3-carboxylate?
The InChIKey is DFYHULXZXQOJEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2NO2/c1-10(2,3)15-9(14)7-6(11)4-5-13-8(7)12/h4-5H,1-3H3.
What are the key properties of tert-butyl 2,4-dichloropyridine-3-carboxylate?
tert-butyl 2,4-dichloropyridine-3-carboxylate has a molecular weight of 248.11 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,4-dichloropyridine-3-carboxylate is sourced from PubChem (CID 58208973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).