About 2-butoxy-4-methyl-1,3,2-dioxaborinane
2-butoxy-4-methyl-1,3,2-dioxaborinane (PubChem CID 582093) has the molecular formula C8H17BO3
and a molecular weight of 172.03 g/mol. Its IUPAC name is 2-butoxy-4-methyl-1,3,2-dioxaborinane.
Molecular Properties
| Compound Name | 2-butoxy-4-methyl-1,3,2-dioxaborinane |
| PubChem CID | 582093 |
| Molecular Formula | C8H17BO3 |
| Molecular Weight | 172.03 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2-butoxy-4-methyl-1,3,2-dioxaborinane |
| SMILES | CCCCOB1OCCC(C)O1 |
| InChI | InChI=1S/C8H17BO3/c1-3-4-6-10-9-11-7-5-8(2)12-9/h8H,3-7H2,1-2H3 |
| InChIKey | SRBXACXHFHLBGV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.03 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-4-methyl-1,3,2-dioxaborinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-4-methyl-1,3,2-dioxaborinane?
The IUPAC name of 2-butoxy-4-methyl-1,3,2-dioxaborinane (CID 582093) is 2-butoxy-4-methyl-1,3,2-dioxaborinane.
What is the SMILES notation for 2-butoxy-4-methyl-1,3,2-dioxaborinane?
The canonical SMILES for 2-butoxy-4-methyl-1,3,2-dioxaborinane is CCCCOB1OCCC(C)O1.
What is the InChIKey of 2-butoxy-4-methyl-1,3,2-dioxaborinane?
The InChIKey is SRBXACXHFHLBGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17BO3/c1-3-4-6-10-9-11-7-5-8(2)12-9/h8H,3-7H2,1-2H3.
What are the key properties of 2-butoxy-4-methyl-1,3,2-dioxaborinane?
2-butoxy-4-methyl-1,3,2-dioxaborinane has a molecular weight of 172.03 g/mol, XLogP of 1.61, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-4-methyl-1,3,2-dioxaborinane is sourced from PubChem (CID 582093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).