About [(2R)-4,4,7-trimethyl-1-nitrooxyoctan-2-yl] nitrate
[(2R)-4,4,7-trimethyl-1-nitrooxyoctan-2-yl] nitrate (PubChem CID 58209307) has the molecular formula C11H22N2O6
and a molecular weight of 278.31 g/mol. Its IUPAC name is [(2R)-4,4,7-trimethyl-1-nitrooxyoctan-2-yl] nitrate.
Molecular Properties
| Compound Name | [(2R)-4,4,7-trimethyl-1-nitrooxyoctan-2-yl] nitrate |
| PubChem CID | 58209307 |
| Molecular Formula | C11H22N2O6 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [(2R)-4,4,7-trimethyl-1-nitrooxyoctan-2-yl] nitrate |
| SMILES | CC(C)CCC(C)(C)C[C@H](CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C11H22N2O6/c1-9(2)5-6-11(3,4)7-10(19-13(16)17)8-18-12(14)15/h9-10H,5-8H2,1-4H3/t10-/m1/s1 |
| InChIKey | QXGKGTAVPOJWDT-SNVBAGLBSA-N |
| XLogP | 2.62 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-4,4,7-trimethyl-1-nitrooxyoctan-2-yl] nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4,4,7-trimethyl-1-nitrooxyoctan-2-yl] nitrate?
The IUPAC name of [(2R)-4,4,7-trimethyl-1-nitrooxyoctan-2-yl] nitrate (CID 58209307) is [(2R)-4,4,7-trimethyl-1-nitrooxyoctan-2-yl] nitrate.
What is the SMILES notation for [(2R)-4,4,7-trimethyl-1-nitrooxyoctan-2-yl] nitrate?
The canonical SMILES for [(2R)-4,4,7-trimethyl-1-nitrooxyoctan-2-yl] nitrate is CC(C)CCC(C)(C)C[C@H](CO[N+](=O)[O-])O[N+](=O)[O-].
What is the InChIKey of [(2R)-4,4,7-trimethyl-1-nitrooxyoctan-2-yl] nitrate?
The InChIKey is QXGKGTAVPOJWDT-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H22N2O6/c1-9(2)5-6-11(3,4)7-10(19-13(16)17)8-18-12(14)15/h9-10H,5-8H2,1-4H3/t10-/m1/s1.
What are the key properties of [(2R)-4,4,7-trimethyl-1-nitrooxyoctan-2-yl] nitrate?
[(2R)-4,4,7-trimethyl-1-nitrooxyoctan-2-yl] nitrate has a molecular weight of 278.31 g/mol, XLogP of 2.62, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4,4,7-trimethyl-1-nitrooxyoctan-2-yl] nitrate is sourced from PubChem (CID 58209307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).