C12H18N2O11 — CID 58209361
[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (5R)-5,6-dinitrooxyhexanoate (PubChem CID 58209361) has the molecular formula C12H18N2O11 and a molecular weight of 366.28 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (5R)-5,6-dinitrooxyhexanoate.
| Compound Name | [(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (5R)-5,6-dinitrooxyhexanoate |
|---|---|
| PubChem CID | 58209361 |
| Molecular Formula | C12H18N2O11 |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | [(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (5R)-5,6-dinitrooxyhexanoate |
| SMILES | O=C(CCC[C@H](CO[N+](=O)[O-])O[N+](=O)[O-])O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2O |
| InChI | InChI=1S/C12H18N2O11/c15-8-5-21-12-9(6-22-11(8)12)24-10(16)3-1-2-7(25-14(19)20)4-23-13(17)18/h7-9,11-12,15H,1-6H2/t7-,8-,9-,11-,12-/m1/s1 |
| InChIKey | HLBYTUKKFDKGBQ-VFWMFTPISA-N |
| XLogP | -0.99 |
| TPSA | 169.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|