C21H18Cl2N2O3S3 — CID 58209684
4-[3-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzenesulfonamide (PubChem CID 58209684) has the molecular formula C21H18Cl2N2O3S3 and a molecular weight of 513.49 g/mol. Its IUPAC name is 4-[3-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzenesulfonamide.
| Compound Name | 4-[3-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 58209684 |
| Molecular Formula | C21H18Cl2N2O3S3 |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 511.99 |
| IUPAC Name | 4-[3-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzenesulfonamide |
| SMILES | C/C(=N\CC(=S)Cc1ccc(S(N)(=O)=O)cc1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C21H18Cl2N2O3S3/c1-12(17-11-30-21(20(17)26)14-4-7-18(22)19(23)9-14)25-10-15(29)8-13-2-5-16(6-3-13)31(24,27)28/h2-7,9,11,26H,8,10H2,1H3,(H2,24,27,28)/b25-12+ |
| InChIKey | GXYZXWRDNFBJHE-BRJLIKDPSA-N |
| XLogP | 5.50 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|