C21H16Cl2KNO4S3 — CID 58209818
potassium 4-[3-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzenesulfonate (PubChem CID 58209818) has the molecular formula C21H16Cl2KNO4S3 and a molecular weight of 552.57 g/mol. Its IUPAC name is potassium 4-[3-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzenesulfonate.
| Compound Name | potassium 4-[3-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzenesulfonate |
|---|---|
| PubChem CID | 58209818 |
| Molecular Formula | C21H16Cl2KNO4S3 |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 550.93 |
| IUPAC Name | potassium 4-[3-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzenesulfonate |
| SMILES | C/C(=N\CC(=S)Cc1ccc(S(=O)(=O)[O-])cc1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O.[K+] |
| InChI | InChI=1S/C21H17Cl2NO4S3.K/c1-12(17-11-30-21(20(17)25)14-4-7-18(22)19(23)9-14)24-10-15(29)8-13-2-5-16(6-3-13)31(26,27)28;/h2-7,9,11,25H,8,10H2,1H3,(H,26,27,28);/q;+1/p-1/b24-12+; |
| InChIKey | WYEIDZPDKDYEEQ-DFVQGABXSA-M |
| XLogP | 2.76 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|