C22H19Cl2NO2S2 — CID 58209826
1-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-3-[3-(hydroxymethyl)phenyl]propane-2-thione (PubChem CID 58209826) has the molecular formula C22H19Cl2NO2S2 and a molecular weight of 464.44 g/mol. Its IUPAC name is 1-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-3-[3-(hydroxymethyl)phenyl]propane-2-thione.
| Compound Name | 1-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-3-[3-(hydroxymethyl)phenyl]propane-2-thione |
|---|---|
| PubChem CID | 58209826 |
| Molecular Formula | C22H19Cl2NO2S2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | 1-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-3-[3-(hydroxymethyl)phenyl]propane-2-thione |
| SMILES | C/C(=N\CC(=S)Cc1cccc(CO)c1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C22H19Cl2NO2S2/c1-13(25-10-17(28)8-14-3-2-4-15(7-14)11-26)18-12-29-22(21(18)27)16-5-6-19(23)20(24)9-16/h2-7,9,12,26-27H,8,10-11H2,1H3/b25-13+ |
| InChIKey | ZRVPGDSGVLDWRS-DHRITJCHSA-N |
| XLogP | 6.34 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|