C15H26S — CID 58210287
4,6-diethylspiro[1,3a,4,5,6,6a-hexahydrocyclopenta[c]thiophene-3,1'-cyclopentane] (PubChem CID 58210287) has the molecular formula C15H26S and a molecular weight of 238.44 g/mol. Its IUPAC name is 4,6-diethylspiro[1,3a,4,5,6,6a-hexahydrocyclopenta[c]thiophene-3,1'-cyclopentane].
| Compound Name | 4,6-diethylspiro[1,3a,4,5,6,6a-hexahydrocyclopenta[c]thiophene-3,1'-cyclopentane] |
|---|---|
| PubChem CID | 58210287 |
| Molecular Formula | C15H26S |
| Molecular Weight | 238.44 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 4,6-diethylspiro[1,3a,4,5,6,6a-hexahydrocyclopenta[c]thiophene-3,1'-cyclopentane] |
| SMILES | CCC1CC(CC)C2C1CSC21CCCC1 |
| InChI | InChI=1S/C15H26S/c1-3-11-9-12(4-2)14-13(11)10-16-15(14)7-5-6-8-15/h11-14H,3-10H2,1-2H3 |
| InChIKey | HTTQLBUXRBRDFV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |