About (2R)-2-amino-3-(2,2-dimethylpropylamino)propanoic acid
(2R)-2-amino-3-(2,2-dimethylpropylamino)propanoic acid (PubChem CID 58210412) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is (2R)-2-amino-3-(2,2-dimethylpropylamino)propanoic acid.
Molecular Properties
| Compound Name | (2R)-2-amino-3-(2,2-dimethylpropylamino)propanoic acid |
| PubChem CID | 58210412 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (2R)-2-amino-3-(2,2-dimethylpropylamino)propanoic acid |
| SMILES | CC(C)(C)CNC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C8H18N2O2/c1-8(2,3)5-10-4-6(9)7(11)12/h6,10H,4-5,9H2,1-3H3,(H,11,12)/t6-/m1/s1 |
| InChIKey | INGWTSFESJFNEV-ZCFIWIBFSA-N |
| XLogP | 0.03 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-amino-3-(2,2-dimethylpropylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3-(2,2-dimethylpropylamino)propanoic acid?
The IUPAC name of (2R)-2-amino-3-(2,2-dimethylpropylamino)propanoic acid (CID 58210412) is (2R)-2-amino-3-(2,2-dimethylpropylamino)propanoic acid.
What is the SMILES notation for (2R)-2-amino-3-(2,2-dimethylpropylamino)propanoic acid?
The canonical SMILES for (2R)-2-amino-3-(2,2-dimethylpropylamino)propanoic acid is CC(C)(C)CNC[C@@H](N)C(=O)O.
What is the InChIKey of (2R)-2-amino-3-(2,2-dimethylpropylamino)propanoic acid?
The InChIKey is INGWTSFESJFNEV-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H18N2O2/c1-8(2,3)5-10-4-6(9)7(11)12/h6,10H,4-5,9H2,1-3H3,(H,11,12)/t6-/m1/s1.
What are the key properties of (2R)-2-amino-3-(2,2-dimethylpropylamino)propanoic acid?
(2R)-2-amino-3-(2,2-dimethylpropylamino)propanoic acid has a molecular weight of 174.24 g/mol, XLogP of 0.03, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-(2,2-dimethylpropylamino)propanoic acid is sourced from PubChem (CID 58210412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).