C15H24O5 — CID 58210472
[(2S,3R,4S,5S,6S)-2-acetyloxy-6-ethenyl-6-ethyl-4,5-dimethyloxan-3-yl] acetate (PubChem CID 58210472) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6S)-2-acetyloxy-6-ethenyl-6-ethyl-4,5-dimethyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5S,6S)-2-acetyloxy-6-ethenyl-6-ethyl-4,5-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 58210472 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | [(2S,3R,4S,5S,6S)-2-acetyloxy-6-ethenyl-6-ethyl-4,5-dimethyloxan-3-yl] acetate |
| SMILES | C=C[C@]1(CC)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C15H24O5/c1-7-15(8-2)10(4)9(3)13(18-11(5)16)14(20-15)19-12(6)17/h7,9-10,13-14H,1,8H2,2-6H3/t9-,10-,13+,14+,15+/m0/s1 |
| InChIKey | ZPLFQKHTBLBZIZ-CBNCNZKNSA-N |
| XLogP | 2.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|