C23H25F3N2O3S — CID 58210598
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[6-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]-2-pyridinyl]methanone (PubChem CID 58210598) has the molecular formula C23H25F3N2O3S and a molecular weight of 466.53 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[6-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]-2-pyridinyl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[6-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 58210598 |
| Molecular Formula | C23H25F3N2O3S |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[6-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]-2-pyridinyl]methanone |
| SMILES | O=C(c1cccc(CS(=O)(=O)c2cccc(C(F)(F)F)c2)n1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C23H25F3N2O3S/c24-23(25,26)17-8-3-10-19(14-17)32(30,31)15-18-9-4-11-20(27-18)22(29)28-13-5-7-16-6-1-2-12-21(16)28/h3-4,8-11,14,16,21H,1-2,5-7,12-13,15H2 |
| InChIKey | QXTDTUUZHCNHLO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |