About [6-[(2,5-dichloro-4-methylphenyl)sulfonylmethyl]-2-pyridinyl]-piperidin-1-ylmethanone
[6-[(2,5-dichloro-4-methylphenyl)sulfonylmethyl]-2-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 58210717) has the molecular formula C19H20Cl2N2O3S
and a molecular weight of 427.35 g/mol. Its IUPAC name is [6-[(2,5-dichloro-4-methylphenyl)sulfonylmethyl]-2-pyridinyl]-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | [6-[(2,5-dichloro-4-methylphenyl)sulfonylmethyl]-2-pyridinyl]-piperidin-1-ylmethanone |
| PubChem CID | 58210717 |
| Molecular Formula | C19H20Cl2N2O3S |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | [6-[(2,5-dichloro-4-methylphenyl)sulfonylmethyl]-2-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | Cc1cc(Cl)c(S(=O)(=O)Cc2cccc(C(=O)N3CCCCC3)n2)cc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O3S/c1-13-10-16(21)18(11-15(13)20)27(25,26)12-14-6-5-7-17(22-14)19(24)23-8-3-2-4-9-23/h5-7,10-11H,2-4,8-9,12H2,1H3 |
| InChIKey | PCFOFPXUKSWWAR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [6-[(2,5-dichloro-4-methylphenyl)sulfonylmethyl]-2-pyridinyl]-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[(2,5-dichloro-4-methylphenyl)sulfonylmethyl]-2-pyridinyl]-piperidin-1-ylmethanone?
The IUPAC name of [6-[(2,5-dichloro-4-methylphenyl)sulfonylmethyl]-2-pyridinyl]-piperidin-1-ylmethanone (CID 58210717) is [6-[(2,5-dichloro-4-methylphenyl)sulfonylmethyl]-2-pyridinyl]-piperidin-1-ylmethanone.
What is the SMILES notation for [6-[(2,5-dichloro-4-methylphenyl)sulfonylmethyl]-2-pyridinyl]-piperidin-1-ylmethanone?
The canonical SMILES for [6-[(2,5-dichloro-4-methylphenyl)sulfonylmethyl]-2-pyridinyl]-piperidin-1-ylmethanone is Cc1cc(Cl)c(S(=O)(=O)Cc2cccc(C(=O)N3CCCCC3)n2)cc1Cl.
What is the InChIKey of [6-[(2,5-dichloro-4-methylphenyl)sulfonylmethyl]-2-pyridinyl]-piperidin-1-ylmethanone?
The InChIKey is PCFOFPXUKSWWAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20Cl2N2O3S/c1-13-10-16(21)18(11-15(13)20)27(25,26)12-14-6-5-7-17(22-14)19(24)23-8-3-2-4-9-23/h5-7,10-11H,2-4,8-9,12H2,1H3.
What are the key properties of [6-[(2,5-dichloro-4-methylphenyl)sulfonylmethyl]-2-pyridinyl]-piperidin-1-ylmethanone?
[6-[(2,5-dichloro-4-methylphenyl)sulfonylmethyl]-2-pyridinyl]-piperidin-1-ylmethanone has a molecular weight of 427.35 g/mol, XLogP of 4.30, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[(2,5-dichloro-4-methylphenyl)sulfonylmethyl]-2-pyridinyl]-piperidin-1-ylmethanone is sourced from PubChem (CID 58210717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).