C22H24Cl2N2O2 — CID 58210767
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-[(2,6-dichlorophenoxy)methyl]-3-pyridinyl]methanone (PubChem CID 58210767) has the molecular formula C22H24Cl2N2O2 and a molecular weight of 419.35 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-[(2,6-dichlorophenoxy)methyl]-3-pyridinyl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-[(2,6-dichlorophenoxy)methyl]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 58210767 |
| Molecular Formula | C22H24Cl2N2O2 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-[(2,6-dichlorophenoxy)methyl]-3-pyridinyl]methanone |
| SMILES | O=C(c1cncc(COc2c(Cl)cccc2Cl)c1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C22H24Cl2N2O2/c23-18-7-3-8-19(24)21(18)28-14-15-11-17(13-25-12-15)22(27)26-10-4-6-16-5-1-2-9-20(16)26/h3,7-8,11-13,16,20H,1-2,4-6,9-10,14H2 |
| InChIKey | DFYXRMNSIUJFHJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |