C21H23Cl3N2O3S — CID 58210817
(5-ethyl-2-methylpiperidin-1-yl)-[6-[(2,4,5-trichlorophenyl)sulfonylmethyl]-2-pyridinyl]methanone (PubChem CID 58210817) has the molecular formula C21H23Cl3N2O3S and a molecular weight of 489.85 g/mol. Its IUPAC name is (5-ethyl-2-methylpiperidin-1-yl)-[6-[(2,4,5-trichlorophenyl)sulfonylmethyl]-2-pyridinyl]methanone.
| Compound Name | (5-ethyl-2-methylpiperidin-1-yl)-[6-[(2,4,5-trichlorophenyl)sulfonylmethyl]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 58210817 |
| Molecular Formula | C21H23Cl3N2O3S |
| Molecular Weight | 489.85 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | (5-ethyl-2-methylpiperidin-1-yl)-[6-[(2,4,5-trichlorophenyl)sulfonylmethyl]-2-pyridinyl]methanone |
| SMILES | CCC1CCC(C)N(C(=O)c2cccc(CS(=O)(=O)c3cc(Cl)c(Cl)cc3Cl)n2)C1 |
| InChI | InChI=1S/C21H23Cl3N2O3S/c1-3-14-8-7-13(2)26(11-14)21(27)19-6-4-5-15(25-19)12-30(28,29)20-10-17(23)16(22)9-18(20)24/h4-6,9-10,13-14H,3,7-8,11-12H2,1-2H3 |
| InChIKey | RVQFHMLDFNJVIC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.85 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|