C22H26N4O2S — CID 58210850
4-[6-(4-piperidin-1-ylpiperidin-1-yl)sulfonyl-2-pyridinyl]benzonitrile (PubChem CID 58210850) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 4-[6-(4-piperidin-1-ylpiperidin-1-yl)sulfonyl-2-pyridinyl]benzonitrile.
| Compound Name | 4-[6-(4-piperidin-1-ylpiperidin-1-yl)sulfonyl-2-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 58210850 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 4-[6-(4-piperidin-1-ylpiperidin-1-yl)sulfonyl-2-pyridinyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cccc(S(=O)(=O)N3CCC(N4CCCCC4)CC3)n2)cc1 |
| InChI | InChI=1S/C22H26N4O2S/c23-17-18-7-9-19(10-8-18)21-5-4-6-22(24-21)29(27,28)26-15-11-20(12-16-26)25-13-2-1-3-14-25/h4-10,20H,1-3,11-16H2 |
| InChIKey | JAHZHCMFRSFBRR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |